Browse A
Alphabetical listing with fast deep pagination.
167681 items • Page 3176 / 3354
a) $1,381,965 b) $1,454,700 c) $122,965 d) $195,700 Woodridge Corporation manufa
a) $1,381,965 b) $1,454,700 c) $122,965 d) $195,700 Woodridge Corporation manufactures numerous products, one of which is called Alpha-32. The company has provided the following d…
a) $1,496 favorable b) $1,496 unfavorable c) $1,400 favorable d) $1,400 unfavora
a) $1,496 favorable b) $1,496 unfavorable c) $1,400 favorable d) $1,400 unfavorable Lossing Corporation applies manufacturing overhead to products on the basis of standard machine…
a) $4,600 54,000 3,500 53,000 52,500 $2,000 $1,500 $1,co0 3500 S0 $4,500 54,000
a) $4,600 54,000 3,500 53,000 52,500 $2,000 $1,500 $1,co0 3500 S0 $4,500 54,000 53.000 52,500 $2.000 51,500 $1,000 $500 S0 2,000 4,000 6,000 8,000 10,000 2,000 4,000 6,0 8,000 10,…
a) ( The graph below shows an oscilloscope trace of a sinusoidal voltage signal
a) (The graph below shows an oscilloscope trace of a sinusoidal voltage signal as a function of time. For the graph shown below the vertical volts per division is 1.0 V/div an…
a) (1.1)2, (1.1)10, (1.1)16............The number outside the brackets means it
a) (1.1)2, (1.1)10, (1.1)16............The number outside the brackets means it is a base. e.g (1.1)2 means 1.1 base-2 b) (11.1)2, (11.1)10, (11.1)16 c) (10011)2, (14)10, (12)16 b…
a) (1.1)2, (1.1)10, (1.1)16............The number outside the brackets means it
a) (1.1)2, (1.1)10, (1.1)16............The number outside the brackets means it is a base. e.g (1.1)2 means 1.1 base-2 b) (11.1)2, (11.1)10, (11.1)16 c) (10011)2, (14)10, (12)16 b…
a) (10 points) Create a PHP page to read one name. Add input validation such tha
a) (10 points) Create a PHP page to read one name. Add input validation such that the name is required, and only contains letters and white space (see PHP tutorial). You do not ha…
a) (10 points) Create a PHP page to read one name. Add input validation such tha
a) (10 points) Create a PHP page to read one name. Add input validation such that the name is required, and only contains letters and white space. You do not have to modify the in…
a) (10 points) Create a PHP page to read one name. Add input validation such tha
a) (10 points) Create a PHP page to read one name. Add input validation such that the name is required, and only contains letters and white space. You do not have to modify the in…
a) (10 points) Create a PHP page to read one name. Add input validation such tha
a) (10 points) Create a PHP page to read one name. Add input validation such that the name is required, and only contains letters and white space. You do not have to modify the in…
a) (12 points) Only small animals hibernate (not completely true...black bears a
a) (12 points) Only small animals hibernate (not completely true...black bears are now believed to hibernate, however it's a different mechanism than small animals-more on this la…
a) (12 points) Only small animals hibernate (not completely true...black bears a
a) (12 points) Only small animals hibernate (not completely true...black bears are now believed to hibernate, however it's a different mechanism than small animals-more on this la…
a) (12 points) Only small animals hibernate (not completely true...black bears a
a) (12 points) Only small animals hibernate (not completely true...black bears are now believed to hibernate, however it's a different mechanism than small animals-more on this la…
a) (2 marks for each part) Clearly indicate one preferred method of metal remova
a) (2 marks for each part) Clearly indicate one preferred method of metal removal in your choice of the following situatio involving steel members i) the teeth on an internal gear…
a) (2 points) What percent of males did not visit a fast food restaurant in the
a) (2 points) What percent of males did not visit a fast food restaurant in the past 7 days? b) (4 points) Test the following hypothesis: Ho: There is no relationship between gend…
a) (2 pts) Write a Matlab function f = randnum(a,b) which takes as input two int
a) (2 pts) Write a Matlab function f = randnum(a,b) which takes as input two integers a and b, and generates and returns a random integer that is equally likely to take any value …
a) (3x^2+3xy^2)dx+(3x^2-3y^2+2y)dy=0 Integrated both with respect to x and y x^3
a) (3x^2+3xy^2)dx+(3x^2-3y^2+2y)dy=0 Integrated both with respect to x and y x^3+(3/2)x^2y^2+c+(3/2)x^2y^2-y^3+y^2=0 But the answer is x^3+(3/2)x^2y^2-y^3+y^2=0 b) y^3sinx dx - 3y…
a) (4 points) You are given an initially empty queue and perform the following o
a) (4 points) You are given an initially empty queue and perform the following operations on it: enqueue(B), enqueue(A), enqueue(T), enqueue(I), dequeue), dequeue), enqueue(Z), en…
a) (4 pts) Calculate the sensitivity and specificity of the HPT kit, and explain
a) (4 pts) Calculate the sensitivity and specificity of the HPT kit, and explain what these numbers mean. b) (1 pt) How many false positives were there in the initial screen? c) (…
a) (4pts) ThHow 2,000,000 put option contract? Three month later in June, what i
a) (4pts) ThHow 2,000,000 put option contract? Three month later in June, what is the company's decision on this of USS that the ll put option? How much is lll company can have? a…
a) (5 marks) The entity for a full adder is given below. library IEEE; use IEEE
a) (5 marks) The entity for a full adder is given below. library IEEE; use IEEE STD LOGIC 1164. all; entity full adder is port x, y, carry in in std logic sum, carry out out std l…
a) (5 marks) The values for three alternatives considered against three criteria
a) (5 marks) The values for three alternatives considered against three criteria are given in the table below. Which is the preferred alternative if comparing alternatives against…
a) (5 points) Fill in the Table below. Number of workers Units of output MPN 0 0
a) (5 points) Fill in the Table below. Number of workers Units of output MPN 0 0 1 20 2 38 3 53 4 66 5 77 6 86 7 93 b. (10 points) Define the marginal pr…
a) (5 points) Use the following bond energies to estimate the value of the stand
a) (5 points) Use the following bond energies to estimate the value of the standard heat of formation (AH 5. of gas phase ammonia from its elements in their standard states. N2(9)…
a) (5) Suppose that a computer manufacturer gets 20% of its chips from supplier
a) (5) Suppose that a computer manufacturer gets 20% of its chips from supplier A, 30% from supplier B, and 50% from supplier C. If chips are randomly installed in computers, dete…
a) (5Marks) Arrange the following in the least to most complexity order. Here n
a) (5Marks) Arrange the following in the least to mostcomplexity order. Here n is the input size for the somecomplexity function and k< j and j & k are numbersgreater…
a) (5Marks) complexity function and k< j and j & k are numbersgreater than1. Arr
a) (5Marks) complexity function and k< j and j & k are numbersgreater than1. Arrange the following in the least to mostcompl…
a) (5pt) Build a regular expression that captures any number in the following fo
a) (5pt) Build a regular expression that captures any number in the following formats: 3.1452926 -212.45 126 1.9e10 For simplicity, assume only a nonnegative integer may appear af…
a) (6 marks) Indicate with clearly-stated reasons which aluminum alloy(s) and te
a) (6 marks) Indicate with clearly-stated reasons which aluminum alloy(s) and temper(s) you would choose for i) a welded energy-absorbing bumper system for a lightweight recreatio…
a) (6 marks) What three measurements (and from what data) do you need to produce
a) (6 marks) What three measurements (and from what data) do you need to produce a plot of absolute magnitude as a function of period for Cepheids? b) (7 marks) Using the lower re…
a) (6 marks) What three measurements (and from what data) do you need to produce
a) (6 marks) What three measurements (and from what data) do you need to produce a plot of absolute magnitude as a function of period for Cepheids? b) (7 marks) Using the lower re…
a) (Figure: Possible Long-Run Outcome) In the figure Possible Long-Run Outcome,
a) (Figure: Possible Long-Run Outcome) In the figure Possible Long-Run Outcome, which price and quantity refer to a potential long-run profit maximizing outcome for a firm produci…
a) (H,H) b) (L,L) c) (L,H) d) (H,L) e) there is no pure strategy nash equilibriu
a) (H,H) b) (L,L) c) (L,H) d) (H,L) e) there is no pure strategy nash equilibrium. n is 5% per year (d-009s capital is valued at $200,000,000. Its rate of io a) Compute HW's earne…
a) (Lease A) Operating lease (Lease B) Capital lease b) (Lease A) Operating leas
a) (Lease A) Operating lease (Lease B) Capital lease b) (Lease A) Operating lease (Lease B) Operating lease c) (Lease A) Capital lease (Lease B) Capital lease d) (L…
a) (rice and French fries) which is the best source of carbohydrates. You should
a) (rice and French fries) which is the best source of carbohydrates. You should take into consideration the type and quantity of carbohydrate present in the food, energy values (…
a) - what atoms must a molecule contain to participate inhydrogen bonding with o
a) - what atoms must a molecule contain to participate inhydrogen bonding with other molecules of the same kind? b) which of the following molecules can form hydrogen bondswith ot…
a) -1153 kJ b) -1124 kJ c) -1395 kJ d) -1199 kJ a) -765 J/mol K b) -410.9 J/mol
a) -1153 kJ b) -1124 kJ c) -1395 kJ d) -1199 kJ a) -765 J/mol K b) -410.9 J/mol K c) 763.8 J/mol K d) -252.5 J/mol K a) 4023 J/mol K b) -761 J/mol K c) 3258 J/mol K d) -4788 J/mol…
a) 0-10% b) 10-20% c) 20-30% d) 40-50% e) More than 50% The graph below show the
a) 0-10% b) 10-20% c) 20-30% d) 40-50% e) More than 50% The graph below show the load for a local Colorado electrical power plant in March. Focus on the light blue curve (Month to…
a) 0-10% b) 10-20% c) 20-30% d) 40-50% e) More than 50% The graph below show the
a) 0-10% b) 10-20% c) 20-30% d) 40-50% e) More than 50% The graph below show the load for a local Colorado electrical power plant in March. Focus on the light blue curve (Month to…
a) 0.01M CH3COONa Weak base CH3COO- + H2O CH3COOH + OH- Kb = [CH3COOH
a) 0.01M CH3COONa Weak base CH3COO- + H2O <--------> CH3COOH + OH- Kb = [CH3COOH][OH-]/[CH3COO-]= 5.71×10^-10 at equillibrium [CH3COOH] = x [ OH-] = x [ CH3COO- ] = 0.01 - x…
a) 0.0400 mol of PH3 gas (MM=33.9976 g/mol) effuses through an orifice in 35 sec
a) 0.0400 mol of PH3 gas (MM=33.9976 g/mol) effuses through an orifice in 35 seconds. How much nitrogen will effuse thru the same orifice in 35 seconds under identical conditions?…
a) 0.10 M NH4Cl b) 0.10 M H3BO3 c) 0.10 M Na2CO3 d) 0.10 M Na2CO3 mixed with 0.1
a) 0.10 M NH4Cl b) 0.10 M H3BO3 c) 0.10 M Na2CO3 d) 0.10 M Na2CO3 mixed with 0.10 M NaHCO3 Give an exmaple of how one of these pH values would be used for the evaluation of equili…
a) 0.20 cm b) 1.7 cm c) 8 cm d) 6.4X103 cmm 2) Here are three isotopes of an ele
a) 0.20 cm b) 1.7 cm c) 8 cm d) 6.4X103 cmm 2) Here are three isotopes of an element: 13C a. The element is: b. The number 6 refers to the c. The numbers 12, 13, and 14 refer to t…
a) 0.35 A counterclockwise b) 0.43 A clockwise c) 0.56 A clockwise d) 0.61 A cou
a) 0.35 A counterclockwise b) 0.43 A clockwise c) 0.56 A clockwise d) 0.61 A counterclockwise A flat coil of wire consists of 20 turns, with an area of 50 cm^2. It is positioned i…
a) 0.5 * 0.7 = b) Bill’s checking account was overdrawn $45. If he deposited $35
a) 0.5 * 0.7 = b) Bill’s checking account was overdrawn $45. If he deposited $35, what is his new balance? c) Aunt Jane’s debts were divided between three of her nieces. If she ow…
a) 0.61 A b) 0.57A c) 0.94A d)0.86A e) 0.0A ( if you cant read the info it is: s
a) 0.61 A b) 0.57A c) 0.94A d)0.86A e) 0.0A ( if you cant read the info it is: starting from the left there is a 100V below that is the switch S. The resistor at the top is…
a) 1 How many pi bonds are present in thismolecule? b) 2 How many understood lon
a) 1 How many pi bonds are present in thismolecule? b) 2 How many understood lone pairs arepresent in this molecule? c) 3 What is the hybridization of the N?Input format: sp, sp^2…
a) 1 b) 4 c) 8 d) 9 e) 16 2. In equilibrium, the rate of growth of the capital s
a) 1 b) 4 c) 8 d) 9 e) 16 2. In equilibrium, the rate of growth of the capital stock in a closed economy is primarily determined by: a) The saving rate. b) The growth rate of savi…
a) 1 kg of steam contained in a horizontal frictionless piston and cylinder is h
a) 1 kg of steam contained in a horizontal frictionless piston and cylinder is heated at a constant pressure of 1.013 bar from 125 C to such a temperature that the volume doubles.…
a) 1,750 b) 3,000 c) 5,500 d) 6,750 a) 400 b) 1,600 c) 1,280 d) 2,200 a) 3,450 b
a) 1,750 b) 3,000 c) 5,500 d) 6,750 a) 400 b) 1,600 c) 1,280 d) 2,200 a) 3,450 b) 4,560 c) 4,610 d) 4,910 a) 46,000 b) 52,000 c) 57,000 d) 63,000 Mansfield Company uses a weighted…