1. Complete the following reactions showing the major organicproduct. (The lota

Question

1. Complete the following reactions showing the major organicproduct. (The lota signs are single and double bonds)

    A.(CH3)2-CH-CH2CH2CH3+ CH3CH2OH
                     
                  Cl
    B.(CH3)2-CH-CH2CH2CH3+CH3CH2O/CH3CH2OH
                     
                  Cl

    C. CH3CH2Br +CH3NH2

    D. (R)-2-chlorobutane +CH3-C-O-Na
                                                
                                               O                            

3. Choose from the following list of C6H13Br isomers that meet eachof the following criteria. There may be more than one answer forsome.

    A. 1-bromohexane
    B. 3-bromo-3-methylpentane
    C. 1-bromo-2,2-dimethylbutane
    D. 3-bromo-2-methylpentane
    E. 2-bromo-3-methylpentane

       1. The compound(s) that can existas enantiomers.

       2. The compound(s) that can existas disastereomers.
   
       3. The compound that gives thefastest SN2 reaction with sodium methoxide.

       4. The compound(s) that give onlyone alkene in an E2 reaction.

       5. The compound(s) that give an E2but no SN2 reaction with sodium methoxide inmethanol.

       6. The compound that gives thefastest SN1 reaction.


Please help!

Explanation / Answer

3. 1. D and E because they both contain chiral centers so they canexist as enantiomers 2. E because it contains two chiral centers so it can exist asdiastereomers 3. A because it is primary alkyl halide and so less sterichindrance. 4. A because because the carbon from which bromine is leaving hasonly one alfa carbon. 5. B because the alkyl halide is tertiary so more sterichindrance so no Sn2 but E2 is possible. 6. B because it is tertiary so gives a stable carbocation so fastSn1 reaction. hope this helps

Related Questions

Navigate

• Browse (All)
• Browse 1
• Subjects

---

---

Integrity-first tutoring: explanations and feedback only — we do not complete graded work. Learn more.