please help with my homework 1. for each of the following examples, predict whet

Question

please help with my homework
1. for each of the following examples, predict whether entroph increases, decreases or stays the same. Briefly justify your prediction
a.H2O(l)-----H2O(s) b. 2Na(s)+2H2O(l)-----2NaOH(aq)+H2(g) c.2C2H6(g)+7O2(g)----4CO2(g)+6H2O(l) d. N2(g)-----2N(g) e. U(s)+3F2(g)-------UF6(s)
2. In many parts of the United States, enthylene glycol is added to a car radiator to prevent the water from freezing during winter. Consider a person living in Fargo, North Dakota where the coldest low temperature in January is -14C. the density of ethylene glycol is 1.11g/mL
a. Calculate the amount in grams of ethylene glycol [CH2(OH)CH2(OH)], that needs to be added to a radiator containing 6.50L of water to prevent the water from freezing in January? Kf of water is 1.85 C/m
b. what is the boiling point of the solution made in question (a) Kb of water is 0.52 C/m

3. define the term "Gibb's Free Energy" and give a short sentence about why this thermodynamic property is useful please help with my homework
1. for each of the following examples, predict whether entroph increases, decreases or stays the same. Briefly justify your prediction
a.H2O(l)-----H2O(s) b. 2Na(s)+2H2O(l)-----2NaOH(aq)+H2(g) c.2C2H6(g)+7O2(g)----4CO2(g)+6H2O(l) d. N2(g)-----2N(g) e. U(s)+3F2(g)-------UF6(s)
2. In many parts of the United States, enthylene glycol is added to a car radiator to prevent the water from freezing during winter. Consider a person living in Fargo, North Dakota where the coldest low temperature in January is -14C. the density of ethylene glycol is 1.11g/mL
a. Calculate the amount in grams of ethylene glycol [CH2(OH)CH2(OH)], that needs to be added to a radiator containing 6.50L of water to prevent the water from freezing in January? Kf of water is 1.85 C/m
b. what is the boiling point of the solution made in question (a) Kb of water is 0.52 C/m

3. define the term "Gibb's Free Energy" and give a short sentence about why this thermodynamic property is useful
1. for each of the following examples, predict whether entroph increases, decreases or stays the same. Briefly justify your prediction
a.H2O(l)-----H2O(s) b. 2Na(s)+2H2O(l)-----2NaOH(aq)+H2(g) c.2C2H6(g)+7O2(g)----4CO2(g)+6H2O(l) d. N2(g)-----2N(g) e. U(s)+3F2(g)-------UF6(s)
2. In many parts of the United States, enthylene glycol is added to a car radiator to prevent the water from freezing during winter. Consider a person living in Fargo, North Dakota where the coldest low temperature in January is -14C. the density of ethylene glycol is 1.11g/mL
a. Calculate the amount in grams of ethylene glycol [CH2(OH)CH2(OH)], that needs to be added to a radiator containing 6.50L of water to prevent the water from freezing in January? Kf of water is 1.85 C/m
b. what is the boiling point of the solution made in question (a) Kb of water is 0.52 C/m

3. define the term "Gibb's Free Energy" and give a short sentence about why this thermodynamic property is useful

Explanation / Answer

1.

a. Here, entropy of the system decreases, as the (l) is converted to more ordered (s).

b. Here, entropy of the system increases, as the products are more disordered (gas phase and aq phase) when compared to reactants (solid and liquid phases).

c.Here, entropy of the system increases, as the number of particles of the products increases than the reactants.

d. Here, entropy of the system increases, as the number of particles of the products increases than the reactants.

e. Here, entropy of the system decreases, as the reactants are converted to more ordered (s).

---------------------------------------------------------

2.

a.

Delta Tf = i x Kf x m

Delta Tf = -14 oC

i = Vant Hoff's factor for ethylene glycol ( non-electrolyte) = 1

14 = 1 x 1.85 x m

m = 7.57

Moles / Kg of solvent = 7.57

Moles of ethylene glycol = 7.57 x 6.50

Moles = 49.20 mol

Mass = Moles x molar mass = 49.20 x 62 = 3051 g

-----------

b.

Delta Tb = i Kb m

Delta Tb = 1 x 0.52 x 7.57

Delta Tb = 3.94

Boiling point of solution = B.P of pure solvent + delta Tb

= 100 + 3.94

= 103.94 oC

-----------------------------------------------------------------------------

3.

The energy associated with a chemical reaction that can be used to do work. The free energy of a system is the sum of its enthalpy (H) plus the product of the temperature (Kelvin) and the entropy (S) of the system

G = H-TS

This property is useful to determine whether, the reaction is spontaneous or not.

Related Questions

Navigate

• Browse (All)
• Browse P
• Subjects

---

---

Integrity-first tutoring: explanations and feedback only — we do not complete graded work. Learn more.