1. As a follow up question, which can Severus use? That is, which one of the fol
ID: 946004 • Letter: 1
Question
1. As a follow up question, which can Severus use? That is, which one of the following is soluble in water.
a. PbI2
b. PbCl2
c. NH3
d. AgCl
e. BaCO3
2. Let's try one more. What is the molecular equation for the reaction of solid calcium carbonate with aqueous acetic acid.
a. CaCO3(s)+2CH3COOH(aq) ? Ca(CH3COO)2(s)+H2O(l)+CO2(g)
b. CaCO3(s)+CH3COOH(aq) ? CaCH3COO(aq)+H2O(l)+CO2(g)
c. CaCO3(s)+CH3COOH(aq) ? CaCH3COO(s)+H2O(l)+CO2(g)
d. CaCO3(s)+2CH3COOH(aq) ? Ca(CH3COO)2(aq)+H2O(l)+CO2(g)
3. Prof. Dumbledore is concerned that Harry, Ron and a few other students are still having some difficulties with significant figures. Hermione seems to have gotten it though. Why don't we try to review them. How many significant figures does the result of the following expression have? (6.635-1.321)*(1747.4)*(3.54-2.6)
a. 1
b. 5
c. 3
d. 4
e. 2
Explanation / Answer
1. NH3 is soluble in water (here hydrogen bond forms between the molecule of water and NH3).
2. CaCO3(s) + 2CH3COOH(aq) = Ca(CH3COO)2(aq) + CO2(g) + H2O(l) (option d)
3. (6.635 - 1.321)*(1747.4)*(3.54-2.6)
= ( 5.314) * 1747.7 * ( 0.94)
= 9287 * (0.94)
= 8729.78
= 8700
so 2 significant figures.
if satisfied please rate it thanks.
Related Questions
Navigate
Integrity-first tutoring: explanations and feedback only — we do not complete graded work. Learn more.