1. For which of the following reactions is it important that the species collide

ID: 931626 • Letter: 1

Question

1. For which of the following reactions is it important that the species collide with the correct orientation?

a. HCl(g) + H2O(l) H2O+(aq) + Cl–(aq) b. Ag+(aq) + Cl–(aq) AgCl(s) c. both of them d. neither of them

2. Which of the following is the equilibrium constant expression for the reaction?

CH3COOH(g) + C2H5OH(g) CH3COOC2H5(g) + H2O(g)

a. K = [CH3COOH][C2H5OH]/[CH3COOC2H5][H2O]

b. K = [CH3COOC2H5][H2O]/[CH3COOH][C2H5OH]

c. K = [CH3COOH][C2H5OH]/[CH3COOC2H5]

d. K = [CH3COOC2H5]/[CH3COOH][C2H5OH]

3. What are the two acids in the following reaction?

NH4+(aq) + HPO42– NH3 + H2PO4–

a. NH4+ and HPO42–

b. NH4+ and NH3

c. HPO42– and H2PO4–

d. NH4+ and H2PO4–

4. Given the following information determine which of these acids is the weakest?

Ka for boric acid is 7.3 10–10 pKa of acetic acid is 4.75 Ka for lactic acid is 8.4 10–4 pKa of phenol is 9.89

a. acetic acid

b. formic acid

c. lactic acid

d. phenol

b. Ag+(aq) + Cl–(aq) ----> AgCl(s)

2. CH3COOH(g) + C2H5OH(g) ------>CH3COOC2H5(g) + H2O(g)

Kc = product of conc of products/product of conc of reactans

b. K = [CH3COOC2H5][H2O]/[CH3COOH][C2H5OH] >>>>>>>>>B answer

3.NH4+(aq) + HPO42– ----->NH3 + H2PO4–

Acid1 Base2 conjugate Base1 conjugat acid2

d. NH4+ and H2PO4– >>>>>>>> D

4. Ka is dissociation constant of acid more Ka value of acid is stron acid

Phenol is a weak acid because it has lowest Ka value 1.6*10-10

Answer >>>>>>>D

Integrity-first tutoring: explanations and feedback only — we do not complete graded work. Learn more.