The following reaction is exothermic. C6H12O6( s )+6O2( g )6CO2( g )+6H2O( g ) P

Question

The following reaction is exothermic.
C6H12O6(s)+6O2(g)6CO2(g)+6H2O(g)
Predict the effect (shift right, shift left, or no effect) of increasing and decreasing the reaction temperature.

Part A

Predict the effect (shift right, shift left, or no effect) of increasing the reaction temperature.

Part B

Predict the effect (shift right, shift left, or no effect) of decreasing the reaction temperature.

Part C

How does the value of the equilibrium constant depend on temperature?

The following reaction is exothermic.
C6H12O6(s)+6O2(g)6CO2(g)+6H2O(g)
Predict the effect (shift right, shift left, or no effect) of increasing and decreasing the reaction temperature.

Part A

Predict the effect (shift right, shift left, or no effect) of increasing the reaction temperature.

Predict the effect (shift right, shift left, or no effect) of increasing the reaction temperature. -shift right -shift left -no effect

Part B

Predict the effect (shift right, shift left, or no effect) of decreasing the reaction temperature.

Predict the effect (shift right, shift left, or no effect) of decreasing the reaction temperature. -shift right -shift left -no effect

Part C

How does the value of the equilibrium constant depend on temperature?

How does the value of the equilibrium constant depend on temperature? -K increases when the temperature increases. -K decreases when the temperature increases. -K stays the same when the temperature increases.

Explanation / Answer

A)
Forward reaction is exothermic in nature
we are increasing temperature or adding heat here
so, according to Le Chatellier's principle,
equilibrium will move in direction which absorbs heat
hence, backward reaction will be favoured
Answer: Shifts left

B)
Forward reaction is exothermic in nature
we are decreasing temperature or removing heat here
so, according to Le Chatellier's principle,
equilibrium will move in direction which release heat
hence, forward reaction will be favoured
Answer: shift right

C)
k decreases with increasing temperature and increases by decreasing temperature
Answer:K decreases when the temperature increases

Related Questions

Navigate

• Browse (All)
• Browse T
• Subjects

---

---

Integrity-first tutoring: explanations and feedback only — we do not complete graded work. Learn more.